C15H22O4 — CID 101157464
ethyl (2R,3R,4R,5S)-3,5-dihydroxy-2,4-dimethyl-5-phenylpentanoate (PubChem CID 101157464) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl (2R,3R,4R,5S)-3,5-dihydroxy-2,4-dimethyl-5-phenylpentanoate.
| Compound Name | ethyl (2R,3R,4R,5S)-3,5-dihydroxy-2,4-dimethyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 101157464 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl (2R,3R,4R,5S)-3,5-dihydroxy-2,4-dimethyl-5-phenylpentanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H](O)[C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H22O4/c1-4-19-15(18)11(3)13(16)10(2)14(17)12-8-6-5-7-9-12/h5-11,13-14,16-17H,4H2,1-3H3/t10-,11-,13-,14+/m1/s1 |
| InChIKey | XMXNJKYCZNYUMU-OXHZDVMGSA-N |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |