C16H22O4 — CID 102242841
ethyl 5-hydroxy-2,2,4-trimethyl-3-oxo-5-phenylpentanoate (PubChem CID 102242841) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 5-hydroxy-2,2,4-trimethyl-3-oxo-5-phenylpentanoate.
| Compound Name | ethyl 5-hydroxy-2,2,4-trimethyl-3-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 102242841 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl 5-hydroxy-2,2,4-trimethyl-3-oxo-5-phenylpentanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)C(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4/c1-5-20-15(19)16(3,4)14(18)11(2)13(17)12-9-7-6-8-10-12/h6-11,13,17H,5H2,1-4H3 |
| InChIKey | DFPKIMZEYLZMFK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|