C31H40O6 — CID 57350685
diethyl 2,2-bis(3,3-dimethyl-2-oxo-1-phenylbutyl)propanedioate (PubChem CID 57350685) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is diethyl 2,2-bis(3,3-dimethyl-2-oxo-1-phenylbutyl)propanedioate.
| Compound Name | diethyl 2,2-bis(3,3-dimethyl-2-oxo-1-phenylbutyl)propanedioate |
|---|---|
| PubChem CID | 57350685 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | diethyl 2,2-bis(3,3-dimethyl-2-oxo-1-phenylbutyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C(C(=O)C(C)(C)C)c1ccccc1)C(C(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C31H40O6/c1-9-36-27(34)31(28(35)37-10-2,23(25(32)29(3,4)5)21-17-13-11-14-18-21)24(26(33)30(6,7)8)22-19-15-12-16-20-22/h11-20,23-24H,9-10H2,1-8H3 |
| InChIKey | GUTXAQHBCRDYTA-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|