C18H21NO3 — CID 102168134
ethyl (2S,3R)-3-anilino-2-hydroxy-2-methyl-3-phenylpropanoate (PubChem CID 102168134) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl (2S,3R)-3-anilino-2-hydroxy-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl (2S,3R)-3-anilino-2-hydroxy-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 102168134 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | ethyl (2S,3R)-3-anilino-2-hydroxy-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@](C)(O)[C@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-3-22-17(20)18(2,21)16(14-10-6-4-7-11-14)19-15-12-8-5-9-13-15/h4-13,16,19,21H,3H2,1-2H3/t16-,18+/m1/s1 |
| InChIKey | AQIMCPYPHVDUBZ-AEFFLSMTSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |