C17H19F2NO5 — CID 11245196
ethyl 5-anilino-4,4-difluoro-5-(furan-2-yl)-3,3-dihydroxypentanoate (PubChem CID 11245196) has the molecular formula C17H19F2NO5 and a molecular weight of 355.34 g/mol. Its IUPAC name is ethyl 5-anilino-4,4-difluoro-5-(furan-2-yl)-3,3-dihydroxypentanoate.
| Compound Name | ethyl 5-anilino-4,4-difluoro-5-(furan-2-yl)-3,3-dihydroxypentanoate |
|---|---|
| PubChem CID | 11245196 |
| Molecular Formula | C17H19F2NO5 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | ethyl 5-anilino-4,4-difluoro-5-(furan-2-yl)-3,3-dihydroxypentanoate |
| SMILES | CCOC(=O)CC(O)(O)C(F)(F)C(Nc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C17H19F2NO5/c1-2-24-14(21)11-16(22,23)17(18,19)15(13-9-6-10-25-13)20-12-7-4-3-5-8-12/h3-10,15,20,22-23H,2,11H2,1H3 |
| InChIKey | JNHDQEJMBNVFMV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|