C19H22FNO3 — CID 139665562
ethyl 2-fluoro-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate (PubChem CID 139665562) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is ethyl 2-fluoro-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate.
| Compound Name | ethyl 2-fluoro-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 139665562 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | ethyl 2-fluoro-3-(4-methoxyanilino)-2-methyl-3-phenylpropanoate |
| SMILES | CCOC(=O)C(C)(F)C(Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22FNO3/c1-4-24-18(22)19(2,20)17(14-8-6-5-7-9-14)21-15-10-12-16(23-3)13-11-15/h5-13,17,21H,4H2,1-3H3 |
| InChIKey | VPGQWIBJGPRVBH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|