C30H43NO6S — CID 101493845
ethyl 7-tert-butylsulfanyl-2,2-diethoxy-5-(4-methoxyanilino)-7-oxo-3-phenylheptanoate (PubChem CID 101493845) has the molecular formula C30H43NO6S and a molecular weight of 545.74 g/mol. Its IUPAC name is ethyl 7-tert-butylsulfanyl-2,2-diethoxy-5-(4-methoxyanilino)-7-oxo-3-phenylheptanoate.
| Compound Name | ethyl 7-tert-butylsulfanyl-2,2-diethoxy-5-(4-methoxyanilino)-7-oxo-3-phenylheptanoate |
|---|---|
| PubChem CID | 101493845 |
| Molecular Formula | C30H43NO6S |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | ethyl 7-tert-butylsulfanyl-2,2-diethoxy-5-(4-methoxyanilino)-7-oxo-3-phenylheptanoate |
| SMILES | CCOC(=O)C(OCC)(OCC)C(CC(CC(=O)SC(C)(C)C)Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H43NO6S/c1-8-35-28(33)30(36-9-2,37-10-3)26(22-14-12-11-13-15-22)20-24(21-27(32)38-29(4,5)6)31-23-16-18-25(34-7)19-17-23/h11-19,24,26,31H,8-10,20-21H2,1-7H3 |
| InChIKey | BCVPZGKQIXIMEI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|