C33H50N2O8 — CID 101401337
diethyl (3R,5S)-3-[4-(dimethylamino)anilino]-2,2,6,6-tetraethoxy-5-phenylheptanedioate (PubChem CID 101401337) has the molecular formula C33H50N2O8 and a molecular weight of 602.77 g/mol. Its IUPAC name is diethyl (3R,5S)-3-[4-(dimethylamino)anilino]-2,2,6,6-tetraethoxy-5-phenylheptanedioate.
| Compound Name | diethyl (3R,5S)-3-[4-(dimethylamino)anilino]-2,2,6,6-tetraethoxy-5-phenylheptanedioate |
|---|---|
| PubChem CID | 101401337 |
| Molecular Formula | C33H50N2O8 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | diethyl (3R,5S)-3-[4-(dimethylamino)anilino]-2,2,6,6-tetraethoxy-5-phenylheptanedioate |
| SMILES | CCOC(=O)C(OCC)(OCC)[C@@H](C[C@@H](c1ccccc1)C(OCC)(OCC)C(=O)OCC)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C33H50N2O8/c1-9-38-30(36)32(40-11-3,41-12-4)28(25-18-16-15-17-19-25)24-29(34-26-20-22-27(23-21-26)35(7)8)33(42-13-5,43-14-6)31(37)39-10-2/h15-23,28-29,34H,9-14,24H2,1-8H3/t28-,29+/m0/s1 |
| InChIKey | RBNTVTDXELZXRF-URLMMPGGSA-N |
| XLogP | 5.37 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|