C19H31NO4 — CID 118194616
methyl 2,2-diethoxy-3-[[(1S)-1-phenylethyl]amino]hexanoate (PubChem CID 118194616) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is methyl 2,2-diethoxy-3-[[(1S)-1-phenylethyl]amino]hexanoate.
| Compound Name | methyl 2,2-diethoxy-3-[[(1S)-1-phenylethyl]amino]hexanoate |
|---|---|
| PubChem CID | 118194616 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | methyl 2,2-diethoxy-3-[[(1S)-1-phenylethyl]amino]hexanoate |
| SMILES | CCCC(N[C@@H](C)c1ccccc1)C(OCC)(OCC)C(=O)OC |
| InChI | InChI=1S/C19H31NO4/c1-6-12-17(20-15(4)16-13-10-9-11-14-16)19(23-7-2,24-8-3)18(21)22-5/h9-11,13-15,17,20H,6-8,12H2,1-5H3/t15-,17?/m0/s1 |
| InChIKey | DNSFLSBKDDHUEN-MYJWUSKBSA-N |
| XLogP | 3.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|