C20H25NO2Se — CID 101397119
ethyl (2R,3R)-3-[[(1R)-1-phenylethyl]amino]-2-phenylselanylbutanoate (PubChem CID 101397119) has the molecular formula C20H25NO2Se and a molecular weight of 390.39 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[(1R)-1-phenylethyl]amino]-2-phenylselanylbutanoate.
| Compound Name | ethyl (2R,3R)-3-[[(1R)-1-phenylethyl]amino]-2-phenylselanylbutanoate |
|---|---|
| PubChem CID | 101397119 |
| Molecular Formula | C20H25NO2Se |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | ethyl (2R,3R)-3-[[(1R)-1-phenylethyl]amino]-2-phenylselanylbutanoate |
| SMILES | CCOC(=O)[C@H]([Se]c1ccccc1)[C@@H](C)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2Se/c1-4-23-20(22)19(24-18-13-9-6-10-14-18)16(3)21-15(2)17-11-7-5-8-12-17/h5-16,19,21H,4H2,1-3H3/t15-,16-,19-/m1/s1 |
| InChIKey | FFALNQFTLSZSDS-GPMSIDNRSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|