C31H47NO3 — CID 121447581
methyl 3-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-methyl-2-(2-phenylpropyl)hexanoate (PubChem CID 121447581) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is methyl 3-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-methyl-2-(2-phenylpropyl)hexanoate.
| Compound Name | methyl 3-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-methyl-2-(2-phenylpropyl)hexanoate |
|---|---|
| PubChem CID | 121447581 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | methyl 3-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-methyl-2-(2-phenylpropyl)hexanoate |
| SMILES | CCCC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)C(C)(CC(C)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C31H47NO3/c1-10-17-27(31(8,29(33)34-9)22-24(4)25-18-13-11-14-19-25)35-32(30(5,6)7)28(23(2)3)26-20-15-12-16-21-26/h11-16,18-21,23-24,27-28H,10,17,22H2,1-9H3 |
| InChIKey | DQPWMMWRYGVIAE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|