C32H41NO3S — CID 59801505
N-tert-butyl-N-[1-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-3-phenylbutoxy]-2-methyl-1-phenylpropan-1-amine (PubChem CID 59801505) has the molecular formula C32H41NO3S and a molecular weight of 519.75 g/mol. Its IUPAC name is N-tert-butyl-N-[1-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-3-phenylbutoxy]-2-methyl-1-phenylpropan-1-amine.
| Compound Name | N-tert-butyl-N-[1-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-3-phenylbutoxy]-2-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 59801505 |
| Molecular Formula | C32H41NO3S |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | N-tert-butyl-N-[1-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-3-phenylbutoxy]-2-methyl-1-phenylpropan-1-amine |
| SMILES | CC(CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccc2c(c1)CS(=O)(=O)C2)c1ccccc1 |
| InChI | InChI=1S/C32H41NO3S/c1-23(2)31(26-15-11-8-12-16-26)33(32(4,5)6)36-30(19-24(3)25-13-9-7-10-14-25)27-17-18-28-21-37(34,35)22-29(28)20-27/h7-18,20,23-24,30-31H,19,21-22H2,1-6H3 |
| InChIKey | JTUMRIZRGUYAGH-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|