C23H32ClNO — CID 125037675
(1S)-N-tert-butyl-N-[(1R)-1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-1-phenylpropan-1-amine (PubChem CID 125037675) has the molecular formula C23H32ClNO and a molecular weight of 373.97 g/mol. Its IUPAC name is (1S)-N-tert-butyl-N-[(1R)-1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-1-phenylpropan-1-amine.
| Compound Name | (1S)-N-tert-butyl-N-[(1R)-1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 125037675 |
| Molecular Formula | C23H32ClNO |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (1S)-N-tert-butyl-N-[(1R)-1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-1-phenylpropan-1-amine |
| SMILES | CC(C)[C@@H](c1ccccc1)N(O[C@H](C)c1ccc(CCl)cc1)C(C)(C)C |
| InChI | InChI=1S/C23H32ClNO/c1-17(2)22(21-10-8-7-9-11-21)25(23(4,5)6)26-18(3)20-14-12-19(16-24)13-15-20/h7-15,17-18,22H,16H2,1-6H3/t18-,22+/m1/s1 |
| InChIKey | WZYBDTCNEIULNZ-GCJKJVERSA-N |
| XLogP | 6.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|