C21H28ClNO — CID 101256886
N-[1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-N-(1-phenylethyl)propan-2-amine (PubChem CID 101256886) has the molecular formula C21H28ClNO and a molecular weight of 345.91 g/mol. Its IUPAC name is N-[1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-N-(1-phenylethyl)propan-2-amine.
| Compound Name | N-[1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-N-(1-phenylethyl)propan-2-amine |
|---|---|
| PubChem CID | 101256886 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[1-[4-(chloromethyl)phenyl]ethoxy]-2-methyl-N-(1-phenylethyl)propan-2-amine |
| SMILES | CC(ON(C(C)c1ccccc1)C(C)(C)C)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C21H28ClNO/c1-16(19-9-7-6-8-10-19)23(21(3,4)5)24-17(2)20-13-11-18(15-22)12-14-20/h6-14,16-17H,15H2,1-5H3 |
| InChIKey | SDMHLLKNDKOFOW-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|