C17H26ClNO2 — CID 170167324
tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]-N-propylcarbamate (PubChem CID 170167324) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 170167324 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl N-[1-[4-(chloromethyl)phenyl]ethyl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)C(C)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C17H26ClNO2/c1-6-11-19(16(20)21-17(3,4)5)13(2)15-9-7-14(12-18)8-10-15/h7-10,13H,6,11-12H2,1-5H3 |
| InChIKey | SJQBYNXMFKIPMU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|