C21H36N2O2 — CID 102569878
tert-butyl N-butyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate (PubChem CID 102569878) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 102569878 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | tert-butyl N-butyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)C(C)c1ccc(C)c(NCCC)c1 |
| InChI | InChI=1S/C21H36N2O2/c1-8-10-14-23(20(24)25-21(5,6)7)17(4)18-12-11-16(3)19(15-18)22-13-9-2/h11-12,15,17,22H,8-10,13-14H2,1-7H3 |
| InChIKey | GFHZZJLEYFDCOS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |