C28H33IN4O4 — CID 90210589
tert-butyl N-[(1S)-1-[4-(4-benzamido-5-iodo-2-oxopyrimidin-1-yl)phenyl]ethyl]-N-butylcarbamate (PubChem CID 90210589) has the molecular formula C28H33IN4O4 and a molecular weight of 616.50 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(4-benzamido-5-iodo-2-oxopyrimidin-1-yl)phenyl]ethyl]-N-butylcarbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(4-benzamido-5-iodo-2-oxopyrimidin-1-yl)phenyl]ethyl]-N-butylcarbamate |
|---|---|
| PubChem CID | 90210589 |
| Molecular Formula | C28H33IN4O4 |
| Molecular Weight | 616.50 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(4-benzamido-5-iodo-2-oxopyrimidin-1-yl)phenyl]ethyl]-N-butylcarbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)[C@@H](C)c1ccc(-n2cc(I)c(NC(=O)c3ccccc3)nc2=O)cc1 |
| InChI | InChI=1S/C28H33IN4O4/c1-6-7-17-32(27(36)37-28(3,4)5)19(2)20-13-15-22(16-14-20)33-18-23(29)24(31-26(33)35)30-25(34)21-11-9-8-10-12-21/h8-16,18-19H,6-7,17H2,1-5H3,(H,30,31,34,35)/t19-/m0/s1 |
| InChIKey | IGCDQUICBCSBKH-IBGZPJMESA-N |
| XLogP | 6.19 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|