C34H58IN3O6Si3 — CID 122232762
N-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]benzamide (PubChem CID 122232762) has the molecular formula C34H58IN3O6Si3 and a molecular weight of 816.01 g/mol. Its IUPAC name is N-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 122232762 |
| Molecular Formula | C34H58IN3O6Si3 |
| Molecular Weight | 816.01 g/mol |
| Exact Mass | 815.27 |
| IUPAC Name | N-[1-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(I)c(NC(=O)c3ccccc3)nc2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H58IN3O6Si3/c1-32(2,3)45(10,11)41-22-25-26(43-46(12,13)33(4,5)6)27(44-47(14,15)34(7,8)9)30(42-25)38-21-24(35)28(37-31(38)40)36-29(39)23-19-17-16-18-20-23/h16-21,25-27,30H,22H2,1-15H3,(H,36,37,39,40)/t25-,26-,27-,30-/m1/s1 |
| InChIKey | GLKPIOXYKHCPCV-NSBPXKJOSA-N |
| XLogP | 8.80 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.01 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|