C25H37N3O5SSi — CID 140837477
N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(ethylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 140837477) has the molecular formula C25H37N3O5SSi and a molecular weight of 519.74 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(ethylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(ethylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 140837477 |
| Molecular Formula | C25H37N3O5SSi |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-[1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(ethylsulfanylmethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CCSCO[C@H]1C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37N3O5SSi/c1-7-34-17-31-19-15-22(33-20(19)16-32-35(5,6)25(2,3)4)28-14-13-21(27-24(28)30)26-23(29)18-11-9-8-10-12-18/h8-14,19-20,22H,7,15-17H2,1-6H3,(H,26,27,29,30)/t19-,20+,22+/m0/s1 |
| InChIKey | FRNWVZFZGXXSRH-TUNNFDKTSA-N |
| XLogP | 4.90 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|