C16H18N3O7P — CID 57341043
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphite (PubChem CID 57341043) has the molecular formula C16H18N3O7P and a molecular weight of 395.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphite.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 57341043 |
| Molecular Formula | C16H18N3O7P |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphite |
| SMILES | O=C(Nc1ccn([C@H]2C[C@H](OP(O)O)[C@@H](CO)O2)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C16H18N3O7P/c20-9-12-11(26-27(23)24)8-14(25-12)19-7-6-13(18-16(19)22)17-15(21)10-4-2-1-3-5-10/h1-7,11-12,14,20,23-24H,8-9H2,(H,17,18,21,22)/t11-,12+,14+/m0/s1 |
| InChIKey | DOTBPPGHIRKFRG-OUCADQQQSA-N |
| XLogP | 0.37 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|