C21H23N3O7 — CID 141051128
[(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methyl-3-oxobutanoate (PubChem CID 141051128) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methyl-3-oxobutanoate.
| Compound Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 141051128 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | [(2R,3S,5R)-5-(4-benzamido-2-oxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] 2-methyl-3-oxobutanoate |
| SMILES | CC(=O)C(C)C(=O)O[C@H]1C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C21H23N3O7/c1-12(13(2)26)20(28)31-15-10-18(30-16(15)11-25)24-9-8-17(23-21(24)29)22-19(27)14-6-4-3-5-7-14/h3-9,12,15-16,18,25H,10-11H2,1-2H3,(H,22,23,27,29)/t12?,15-,16+,18+/m0/s1 |
| InChIKey | FOPBETDDDISFMH-KFYALRJNSA-N |
| XLogP | 0.91 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|