C36H43N3O6Si — CID 154619293
N-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 154619293) has the molecular formula C36H43N3O6Si and a molecular weight of 641.84 g/mol. Its IUPAC name is N-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 154619293 |
| Molecular Formula | C36H43N3O6Si |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | N-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CCOC(C)OC1C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H43N3O6Si/c1-6-42-26(2)44-30-24-33(39-23-22-32(38-35(39)41)37-34(40)27-16-10-7-11-17-27)45-31(30)25-43-46(36(3,4)5,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-23,26,30-31,33H,6,24-25H2,1-5H3,(H,37,38,40,41)/t26?,30?,31-,33-/m1/s1 |
| InChIKey | HKKSPUDUDRXMPR-YDNSKIIQSA-N |
| XLogP | 5.13 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|