C36H44N4O7Si — CID 57150552
N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-(dimethylaminooxy)ethoxy]-3-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 57150552) has the molecular formula C36H44N4O7Si and a molecular weight of 672.86 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-(dimethylaminooxy)ethoxy]-3-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-(dimethylaminooxy)ethoxy]-3-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 57150552 |
| Molecular Formula | C36H44N4O7Si |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-(dimethylaminooxy)ethoxy]-3-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CN(C)OCCO[C@H]1[C@@H](O)[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H44N4O7Si/c1-36(2,3)48(27-17-11-7-12-18-27,28-19-13-8-14-20-28)46-25-29-32(44-23-24-45-39(4)5)31(41)34(47-29)40-22-21-30(38-35(40)43)37-33(42)26-15-9-6-10-16-26/h6-22,29,31-32,34,41H,23-25H2,1-5H3,(H,37,38,42,43)/t29-,31-,32-,34-/m1/s1 |
| InChIKey | HTVJCRMTBPRRGW-UVBUXLLRSA-N |
| XLogP | 3.21 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|