C22H31N3O5SSi — CID 100937051
N-[1-[(2R,3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 100937051) has the molecular formula C22H31N3O5SSi and a molecular weight of 477.66 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 100937051 |
| Molecular Formula | C22H31N3O5SSi |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[1-[(2R,3R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-(sulfanylmethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@@H]1CS |
| InChI | InChI=1S/C22H31N3O5SSi/c1-22(2,3)32(4,5)30-18-15(13-31)29-20(17(18)26)25-12-11-16(24-21(25)28)23-19(27)14-9-7-6-8-10-14/h6-12,15,17-18,20,26,31H,13H2,1-5H3,(H,23,24,27,28)/t15-,17-,18-,20-/m1/s1 |
| InChIKey | WWJDJVDFGIGBMO-DLVXIWMQSA-N |
| XLogP | 3.07 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|