C21H29N3O4SSi — CID 171341738
N-[1-[(2R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 171341738) has the molecular formula C21H29N3O4SSi and a molecular weight of 447.63 g/mol. Its IUPAC name is N-[1-[(2R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 171341738 |
| Molecular Formula | C21H29N3O4SSi |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[1-[(2R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)CS1 |
| InChI | InChI=1S/C21H29N3O4SSi/c1-21(2,3)30(4,5)27-13-18-28-17(14-29-18)24-12-11-16(23-20(24)26)22-19(25)15-9-7-6-8-10-15/h6-12,17-18H,13-14H2,1-5H3,(H,22,23,25,26)/t17-,18+/m0/s1 |
| InChIKey | DBNBSAUDDUTRGZ-ZWKOTPCHSA-N |
| XLogP | 4.11 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|