C26H31N3O4SSi — CID 10255748
N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 10255748) has the molecular formula C26H31N3O4SSi and a molecular weight of 509.70 g/mol. Its IUPAC name is N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 10255748 |
| Molecular Formula | C26H31N3O4SSi |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ccn([C@@H]2CS[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)n1 |
| InChI | InChI=1S/C26H31N3O4SSi/c1-19(30)27-22-15-16-29(25(31)28-22)23-18-34-24(33-23)17-32-35(26(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-16,23-24H,17-18H2,1-4H3,(H,27,28,30,31)/t23-,24+/m0/s1 |
| InChIKey | KNQHWNFLNFSHPH-BJKOFHAPSA-N |
| XLogP | 3.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|