C23H25N3O3SSi — CID 58813312
N-[1-[2-[ethyl(diphenyl)silyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 58813312) has the molecular formula C23H25N3O3SSi and a molecular weight of 451.62 g/mol. Its IUPAC name is N-[1-[2-[ethyl(diphenyl)silyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[2-[ethyl(diphenyl)silyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 58813312 |
| Molecular Formula | C23H25N3O3SSi |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[1-[2-[ethyl(diphenyl)silyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC[Si](c1ccccc1)(c1ccccc1)C1OC(n2ccc(NC(C)=O)nc2=O)CS1 |
| InChI | InChI=1S/C23H25N3O3SSi/c1-3-31(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-29-21(16-30-23)26-15-14-20(24-17(2)27)25-22(26)28/h4-15,21,23H,3,16H2,1-2H3,(H,24,25,27,28) |
| InChIKey | CDGPZGNUNCVQTE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|