C28H37N3O4SSi — CID 11757043
1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-4-(4-hydroxybutylamino)pyrimidin-2-one (PubChem CID 11757043) has the molecular formula C28H37N3O4SSi and a molecular weight of 539.77 g/mol. Its IUPAC name is 1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-4-(4-hydroxybutylamino)pyrimidin-2-one.
| Compound Name | 1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-4-(4-hydroxybutylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 11757043 |
| Molecular Formula | C28H37N3O4SSi |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-4-(4-hydroxybutylamino)pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(NCCCCO)nc2=O)CS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H37N3O4SSi/c1-28(2,3)37(22-12-6-4-7-13-22,23-14-8-5-9-15-23)34-20-26-35-25(21-36-26)31-18-16-24(30-27(31)33)29-17-10-11-19-32/h4-9,12-16,18,25-26,32H,10-11,17,19-21H2,1-3H3,(H,29,30,33)/t25-,26+/m1/s1 |
| InChIKey | JIZUFMRFYARCST-FTJBHMTQSA-N |
| XLogP | 3.59 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|