C14H25N3O3SSi — CID 11256415
4-amino-1-[(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one (PubChem CID 11256415) has the molecular formula C14H25N3O3SSi and a molecular weight of 343.53 g/mol. Its IUPAC name is 4-amino-1-[(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 11256415 |
| Molecular Formula | C14H25N3O3SSi |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-amino-1-[(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)CS1 |
| InChI | InChI=1S/C14H25N3O3SSi/c1-14(2,3)22(4,5)19-8-12-20-11(9-21-12)17-7-6-10(15)16-13(17)18/h6-7,11-12H,8-9H2,1-5H3,(H2,15,16,18)/t11-,12+/m1/s1 |
| InChIKey | UFUWZYRJENPRFN-NEPJUHHUSA-N |
| XLogP | 2.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|