C8H11N3O7PS-3 — CID 56847966
4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one phosphate (PubChem CID 56847966) has the molecular formula C8H11N3O7PS-3 and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one phosphate.
| Compound Name | 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one phosphate |
|---|---|
| PubChem CID | 56847966 |
| Molecular Formula | C8H11N3O7PS-3 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one phosphate |
| SMILES | Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C8H11N3O3S.H3O4P/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6;1-5(2,3)4/h1-2,6-7,12H,3-4H2,(H2,9,10,13);(H3,1,2,3,4)/p-3/t6-,7+;/m0./s1 |
| InChIKey | NHESZXJLKOOZQU-UOERWJHTSA-K |
| XLogP | -3.42 |
| TPSA | 176.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|