C12H19N5O4S — CID 511269
[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl N-(3-aminopropyl)carbamate (PubChem CID 511269) has the molecular formula C12H19N5O4S and a molecular weight of 329.38 g/mol. Its IUPAC name is [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl N-(3-aminopropyl)carbamate.
| Compound Name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 511269 |
| Molecular Formula | C12H19N5O4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl N-(3-aminopropyl)carbamate |
| SMILES | NCCCNC(=O)OC[C@@H]1O[C@H](n2ccc(N)nc2=O)CS1 |
| InChI | InChI=1S/C12H19N5O4S/c13-3-1-4-15-12(19)20-6-10-21-9(7-22-10)17-5-2-8(14)16-11(17)18/h2,5,9-10H,1,3-4,6-7,13H2,(H,15,19)(H2,14,16,18)/t9-,10+/m0/s1 |
| InChIKey | OEWSGRDVFKOIAE-VHSXEESVSA-N |
| XLogP | -0.51 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|