C26H36N6O8S2 — CID 70690680
bis[[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl] decanedioate (PubChem CID 70690680) has the molecular formula C26H36N6O8S2 and a molecular weight of 624.74 g/mol. Its IUPAC name is bis[[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl] decanedioate.
| Compound Name | bis[[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl] decanedioate |
|---|---|
| PubChem CID | 70690680 |
| Molecular Formula | C26H36N6O8S2 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | bis[[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl] decanedioate |
| SMILES | Nc1ccn([C@@H]2CS[C@H](COC(=O)CCCCCCCCC(=O)OC[C@@H]3O[C@H](n4ccc(N)nc4=O)CS3)O2)c(=O)n1 |
| InChI | InChI=1S/C26H36N6O8S2/c27-17-9-11-31(25(35)29-17)19-15-41-23(39-19)13-37-21(33)7-5-3-1-2-4-6-8-22(34)38-14-24-40-20(16-42-24)32-12-10-18(28)30-26(32)36/h9-12,19-20,23-24H,1-8,13-16H2,(H2,27,29,35)(H2,28,30,36)/t19-,20-,23+,24+/m0/s1 |
| InChIKey | XSIBCRFZGTXUQG-UWXQAFAOSA-N |
| XLogP | 2.05 |
| TPSA | 192.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|