C13H19N3O5S — CID 46226983
[(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl butyl carbonate (PubChem CID 46226983) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl butyl carbonate.
| Compound Name | [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl butyl carbonate |
|---|---|
| PubChem CID | 46226983 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [(2S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl butyl carbonate |
| SMILES | CCCCOC(=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)CS1 |
| InChI | InChI=1S/C13H19N3O5S/c1-2-3-6-19-13(18)20-7-11-21-10(8-22-11)16-5-4-9(14)15-12(16)17/h4-5,10-11H,2-3,6-8H2,1H3,(H2,14,15,17)/t10-,11+/m1/s1 |
| InChIKey | YKGNFTVUSIKPPI-MNOVXSKESA-N |
| XLogP | 1.37 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|