C16H24N6O10S3 — CID 78322817
bis(4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one);sulfuric acid (PubChem CID 78322817) has the molecular formula C16H24N6O10S3 and a molecular weight of 556.60 g/mol. Its IUPAC name is bis(4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one);sulfuric acid.
| Compound Name | bis(4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one);sulfuric acid |
|---|---|
| PubChem CID | 78322817 |
| Molecular Formula | C16H24N6O10S3 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.07 |
| IUPAC Name | bis(4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one);sulfuric acid |
| SMILES | Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1.Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1.O=S(=O)(O)O |
| InChI | InChI=1S/2C8H11N3O3S.H2O4S/c2*9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6;1-5(2,3)4/h2*1-2,6-7,12H,3-4H2,(H2,9,10,13);(H2,1,2,3,4)/t2*6-,7+;/m00./s1 |
| InChIKey | NODNJWGZQQCHEZ-INDQVNLWSA-N |
| XLogP | -1.84 |
| TPSA | 255.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|