C8H9N3O3S — CID 170456008
(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carbaldehyde (PubChem CID 170456008) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is (2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carbaldehyde.
| Compound Name | (2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carbaldehyde |
|---|---|
| PubChem CID | 170456008 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carbaldehyde |
| SMILES | Nc1ccn([C@@H]2CS[C@H](C=O)O2)c(=O)n1 |
| InChI | InChI=1S/C8H9N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-3,6-7H,4H2,(H2,9,10,13)/t6-,7+/m0/s1 |
| InChIKey | WFBIFISIUYKIIL-NKWVEPMBSA-N |
| XLogP | -0.39 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|