C8H20N3O15P3S — CID 173006607
4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one;phosphoric acid (PubChem CID 173006607) has the molecular formula C8H20N3O15P3S and a molecular weight of 523.24 g/mol. Its IUPAC name is 4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one;phosphoric acid.
| Compound Name | 4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one;phosphoric acid |
|---|---|
| PubChem CID | 173006607 |
| Molecular Formula | C8H20N3O15P3S |
| Molecular Weight | 523.24 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | 4-amino-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one;phosphoric acid |
| SMILES | Nc1ccn([C@H]2CS[C@@H](CO)O2)c(=O)n1.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C8H11N3O3S.3H3O4P/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6;3*1-5(2,3)4/h1-2,6-7,12H,3-4H2,(H2,9,10,13);3*(H3,1,2,3,4)/t6-,7+;;;/m1.../s1 |
| InChIKey | XICLBKNMSAKHFO-YEIXYONGSA-N |
| XLogP | -3.38 |
| TPSA | 323.65 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.24 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|