C20H35N3O3S — CID 174275747
1-[(5S)-2-(butoxymethyl)-1,3-oxathiolan-5-yl]-4-(dibutylamino)pyrimidin-2-one (PubChem CID 174275747) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-[(5S)-2-(butoxymethyl)-1,3-oxathiolan-5-yl]-4-(dibutylamino)pyrimidin-2-one.
| Compound Name | 1-[(5S)-2-(butoxymethyl)-1,3-oxathiolan-5-yl]-4-(dibutylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 174275747 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-[(5S)-2-(butoxymethyl)-1,3-oxathiolan-5-yl]-4-(dibutylamino)pyrimidin-2-one |
| SMILES | CCCCOCC1O[C@H](n2ccc(N(CCCC)CCCC)nc2=O)CS1 |
| InChI | InChI=1S/C20H35N3O3S/c1-4-7-11-22(12-8-5-2)17-10-13-23(20(24)21-17)18-16-27-19(26-18)15-25-14-9-6-3/h10,13,18-19H,4-9,11-12,14-16H2,1-3H3/t18-,19?/m0/s1 |
| InChIKey | MKNCKGSKEJBURE-OYKVQYDMSA-N |
| XLogP | 4.05 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|