C14H23N3O3S — CID 170058169
4-(butylamino)-1-[(5S)-2-(ethoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (PubChem CID 170058169) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-(butylamino)-1-[(5S)-2-(ethoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one.
| Compound Name | 4-(butylamino)-1-[(5S)-2-(ethoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 170058169 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-(butylamino)-1-[(5S)-2-(ethoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| SMILES | CCCCNc1ccn([C@@H]2CSC(COCC)O2)c(=O)n1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-5-7-15-11-6-8-17(14(18)16-11)12-10-21-13(20-12)9-19-4-2/h6,8,12-13H,3-5,7,9-10H2,1-2H3,(H,15,16,18)/t12-,13?/m0/s1 |
| InChIKey | MXNDZMLJMMMCFF-UEWDXFNNSA-N |
| XLogP | 2.08 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|