C19H31N3O5S — CID 174451863
decyl N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 174451863) has the molecular formula C19H31N3O5S and a molecular weight of 413.54 g/mol. Its IUPAC name is decyl N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | decyl N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 174451863 |
| Molecular Formula | C19H31N3O5S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | decyl N-[1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCCCCOC(=O)Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C19H31N3O5S/c1-2-3-4-5-6-7-8-9-12-26-19(25)21-15-10-11-22(18(24)20-15)16-14-28-17(13-23)27-16/h10-11,16-17,23H,2-9,12-14H2,1H3,(H,20,21,24,25)/t16-,17+/m0/s1 |
| InChIKey | MECXSSPHGLRHQD-DLBZAZTESA-N |
| XLogP | 3.51 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|