C18H25F2N3O6 — CID 175205271
[(3R,5R)-4,4-difluoro-5-[2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 2-methylpropanoate (PubChem CID 175205271) has the molecular formula C18H25F2N3O6 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(3R,5R)-4,4-difluoro-5-[2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,5R)-4,4-difluoro-5-[2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 175205271 |
| Molecular Formula | C18H25F2N3O6 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [(3R,5R)-4,4-difluoro-5-[2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 2-methylpropanoate |
| SMILES | CCCCCOC(=O)Nc1ccn([C@@H]2OC[C@@H](OC(=O)C(C)C)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C18H25F2N3O6/c1-4-5-6-9-27-17(26)22-13-7-8-23(16(25)21-13)15-18(19,20)12(10-28-15)29-14(24)11(2)3/h7-8,11-12,15H,4-6,9-10H2,1-3H3,(H,21,22,25,26)/t12-,15-/m1/s1 |
| InChIKey | LWIOLLSNPZPPEK-IUODEOHRSA-N |
| XLogP | 2.71 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|