C22H26F2N4O7 — CID 90123605
[(2R,3R,5R)-5-[4-(butoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate (PubChem CID 90123605) has the molecular formula C22H26F2N4O7 and a molecular weight of 496.47 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[4-(butoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate.
| Compound Name | [(2R,3R,5R)-5-[4-(butoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 90123605 |
| Molecular Formula | C22H26F2N4O7 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [(2R,3R,5R)-5-[4-(butoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate |
| SMILES | CCCCOC(=O)Nc1ccn([C@@H]2O[C@H](COC(=O)CCc3cccnc3)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C22H26F2N4O7/c1-2-3-11-33-21(32)27-16-8-10-28(20(31)26-16)19-22(23,24)18(30)15(35-19)13-34-17(29)7-6-14-5-4-9-25-12-14/h4-5,8-10,12,15,18-19,30H,2-3,6-7,11,13H2,1H3,(H,26,27,31,32)/t15-,18-,19-/m1/s1 |
| InChIKey | GCILZFUNQJKWFI-ATZDWAIDSA-N |
| XLogP | 2.06 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|