C18H27F2N3O6 — CID 129048342
heptyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 129048342) has the molecular formula C18H27F2N3O6 and a molecular weight of 419.43 g/mol. Its IUPAC name is heptyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | heptyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 129048342 |
| Molecular Formula | C18H27F2N3O6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | heptyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCCOC(=O)Nc1ccn([C@@H]2O[C@H](CCO)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C18H27F2N3O6/c1-2-3-4-5-6-11-28-17(27)22-13-7-9-23(16(26)21-13)15-18(19,20)14(25)12(29-15)8-10-24/h7,9,12,14-15,24-25H,2-6,8,10-11H2,1H3,(H,21,22,26,27)/t12-,14-,15-/m1/s1 |
| InChIKey | OTCGZOKXIYZQQT-BPLDGKMQSA-N |
| XLogP | 2.04 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|