C31H41F2N3O8 — CID 147001028
[(2R,3R,5R)-4,4-difluoro-5-[4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 8-oxo-9-phenylnonanoate (PubChem CID 147001028) has the molecular formula C31H41F2N3O8 and a molecular weight of 621.68 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-5-[4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 8-oxo-9-phenylnonanoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-5-[4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 8-oxo-9-phenylnonanoate |
|---|---|
| PubChem CID | 147001028 |
| Molecular Formula | C31H41F2N3O8 |
| Molecular Weight | 621.68 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-5-[4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-yl] 8-oxo-9-phenylnonanoate |
| SMILES | CCCCCCOC(=O)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](OC(=O)CCCCCCC(=O)Cc3ccccc3)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C31H41F2N3O8/c1-2-3-4-12-19-42-30(41)35-25-17-18-36(29(40)34-25)28-31(32,33)27(24(21-37)43-28)44-26(39)16-11-6-5-10-15-23(38)20-22-13-8-7-9-14-22/h7-9,13-14,17-18,24,27-28,37H,2-6,10-12,15-16,19-21H2,1H3,(H,34,35,40,41)/t24-,27-,28-/m1/s1 |
| InChIKey | ASAONBBRZBMXGM-RYRVMRHHSA-N |
| XLogP | 4.96 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|