C24H29F2N3O7 — CID 90156934
[(2R,3R,5R)-4,4-difluoro-2-(hydroxymethyl)-5-[2-oxo-6-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 3-phenylpropanoate (PubChem CID 90156934) has the molecular formula C24H29F2N3O7 and a molecular weight of 509.51 g/mol. Its IUPAC name is [(2R,3R,5R)-4,4-difluoro-2-(hydroxymethyl)-5-[2-oxo-6-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 3-phenylpropanoate.
| Compound Name | [(2R,3R,5R)-4,4-difluoro-2-(hydroxymethyl)-5-[2-oxo-6-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 90156934 |
| Molecular Formula | C24H29F2N3O7 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [(2R,3R,5R)-4,4-difluoro-2-(hydroxymethyl)-5-[2-oxo-6-(pentoxycarbonylamino)pyrimidin-1-yl]oxolan-3-yl] 3-phenylpropanoate |
| SMILES | CCCCCOC(=O)Nc1ccnc(=O)n1[C@@H]1O[C@H](CO)[C@@H](OC(=O)CCc2ccccc2)C1(F)F |
| InChI | InChI=1S/C24H29F2N3O7/c1-2-3-7-14-34-23(33)28-18-12-13-27-22(32)29(18)21-24(25,26)20(17(15-30)35-21)36-19(31)11-10-16-8-5-4-6-9-16/h4-6,8-9,12-13,17,20-21,30H,2-3,7,10-11,14-15H2,1H3,(H,28,33)/t17-,20-,21-/m1/s1 |
| InChIKey | CMIRNEFKVIXVQW-DUXKGJEZSA-N |
| XLogP | 3.05 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|