C16H23F2N3O5 — CID 162599203
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethyl-4,4-difluorooxolan-3-yl] pentyl carbonate (PubChem CID 162599203) has the molecular formula C16H23F2N3O5 and a molecular weight of 375.37 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethyl-4,4-difluorooxolan-3-yl] pentyl carbonate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethyl-4,4-difluorooxolan-3-yl] pentyl carbonate |
|---|---|
| PubChem CID | 162599203 |
| Molecular Formula | C16H23F2N3O5 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-ethyl-4,4-difluorooxolan-3-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)O[C@@H]1[C@@H](CC)O[C@@H](n2ccc(N)nc2=O)C1(F)F |
| InChI | InChI=1S/C16H23F2N3O5/c1-3-5-6-9-24-15(23)26-12-10(4-2)25-13(16(12,17)18)21-8-7-11(19)20-14(21)22/h7-8,10,12-13H,3-6,9H2,1-2H3,(H2,19,20,22)/t10-,12-,13-/m1/s1 |
| InChIKey | LSDVULUVFGKTTK-RAIGVLPGSA-N |
| XLogP | 2.48 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|