C12H15F2N3O4 — CID 167685078
4-amino-1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(prop-1-enoxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 167685078) has the molecular formula C12H15F2N3O4 and a molecular weight of 303.27 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(prop-1-enoxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(prop-1-enoxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 167685078 |
| Molecular Formula | C12H15F2N3O4 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-amino-1-[(2R,5R)-3,3-difluoro-4-hydroxy-5-(prop-1-enoxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC=COC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(F)(F)C1O |
| InChI | InChI=1S/C12H15F2N3O4/c1-2-5-20-6-7-9(18)12(13,14)10(21-7)17-4-3-8(15)16-11(17)19/h2-5,7,9-10,18H,6H2,1H3,(H2,15,16,19)/t7-,9?,10-/m1/s1 |
| InChIKey | YQERZXVHXGFKNV-DJROOOTPSA-N |
| XLogP | 0.27 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|