C9H10ClF2N3O3 — CID 58364591
4-amino-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 58364591) has the molecular formula C9H10ClF2N3O3 and a molecular weight of 281.65 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58364591 |
| Molecular Formula | C9H10ClF2N3O3 |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-amino-1-[(2R,4R,5S)-5-(chloromethyl)-3,3-difluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@H](CCl)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C9H10ClF2N3O3/c10-3-4-6(16)9(11,12)7(18-4)15-2-1-5(13)14-8(15)17/h1-2,4,6-7,16H,3H2,(H2,13,14,17)/t4-,6-,7-/m1/s1 |
| InChIKey | AELALCJJESWJIH-QPPQHZFASA-N |
| XLogP | -0.04 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|