C10H9F2N3O3 — CID 123309509
4-amino-1-(5-ethynyl-3,3-difluoro-4-hydroxyoxolan-2-yl)pyrimidin-2-one (PubChem CID 123309509) has the molecular formula C10H9F2N3O3 and a molecular weight of 257.20 g/mol. Its IUPAC name is 4-amino-1-(5-ethynyl-3,3-difluoro-4-hydroxyoxolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(5-ethynyl-3,3-difluoro-4-hydroxyoxolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 123309509 |
| Molecular Formula | C10H9F2N3O3 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-amino-1-(5-ethynyl-3,3-difluoro-4-hydroxyoxolan-2-yl)pyrimidin-2-one |
| SMILES | C#CC1OC(n2ccc(N)nc2=O)C(F)(F)C1O |
| InChI | InChI=1S/C10H9F2N3O3/c1-2-5-7(16)10(11,12)8(18-5)15-4-3-6(13)14-9(15)17/h1,3-5,7-8,16H,(H2,13,14,17) |
| InChIKey | RUYMZYVKPFHYIV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|