C12H19F2N3O4Si — CID 10019846
4-amino-1-[3,3-difluoro-4-hydroxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 10019846) has the molecular formula C12H19F2N3O4Si and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-amino-1-[3,3-difluoro-4-hydroxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3,3-difluoro-4-hydroxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10019846 |
| Molecular Formula | C12H19F2N3O4Si |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-amino-1-[3,3-difluoro-4-hydroxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C[Si](C)(C)OCC1OC(n2ccc(N)nc2=O)C(F)(F)C1O |
| InChI | InChI=1S/C12H19F2N3O4Si/c1-22(2,3)20-6-7-9(18)12(13,14)10(21-7)17-5-4-8(15)16-11(17)19/h4-5,7,9-10,18H,6H2,1-3H3,(H2,15,16,19) |
| InChIKey | IMBVYWZTWSHQMQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|