C26H41F2N3O5 — CID 71465247
[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (E)-heptadec-8-enoate (PubChem CID 71465247) has the molecular formula C26H41F2N3O5 and a molecular weight of 513.63 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (E)-heptadec-8-enoate.
| Compound Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (E)-heptadec-8-enoate |
|---|---|
| PubChem CID | 71465247 |
| Molecular Formula | C26H41F2N3O5 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | [(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4,4-difluoro-3-hydroxyoxolan-2-yl]methyl (E)-heptadec-8-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(F)(F)[C@@H]1O |
| InChI | InChI=1S/C26H41F2N3O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22(32)35-19-20-23(33)26(27,28)24(36-20)31-18-17-21(29)30-25(31)34/h9-10,17-18,20,23-24,33H,2-8,11-16,19H2,1H3,(H2,29,30,34)/b10-9+/t20-,23-,24-/m1/s1 |
| InChIKey | GKDMVTCZCHDONE-NRPZEPFBSA-N |
| XLogP | 4.91 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|